C32H36O5S — CID 144692397
3-[4-[[13-[(1-oxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]butanoic acid (PubChem CID 144692397) has the molecular formula C32H36O5S and a molecular weight of 532.70 g/mol. Its IUPAC name is 3-[4-[[13-[(1-oxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]butanoic acid.
| Compound Name | 3-[4-[[13-[(1-oxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]butanoic acid |
|---|---|
| PubChem CID | 144692397 |
| Molecular Formula | C32H36O5S |
| Molecular Weight | 532.70 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 3-[4-[[13-[(1-oxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]butanoic acid |
| SMILES | CC(CC(=O)O)c1ccc(OCc2ccc3c(c2)-c2ccc(OCC4CCS(=O)CC4)cc2CCC3)cc1 |
| InChI | InChI=1S/C32H36O5S/c1-22(17-32(33)34)25-7-9-28(10-8-25)36-21-24-5-6-26-3-2-4-27-19-29(11-12-30(27)31(26)18-24)37-20-23-13-15-38(35)16-14-23/h5-12,18-19,22-23H,2-4,13-17,20-21H2,1H3,(H,33,34) |
| InChIKey | IRQWODDYOQJIBU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.70 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |