C34H38O6S — CID 118619077
(3R)-3-cyclopropyl-3-[3-[[13-[(1,1-dioxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]propanoic acid (PubChem CID 118619077) has the molecular formula C34H38O6S and a molecular weight of 574.74 g/mol. Its IUPAC name is (3R)-3-cyclopropyl-3-[3-[[13-[(1,1-dioxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]propanoic acid.
| Compound Name | (3R)-3-cyclopropyl-3-[3-[[13-[(1,1-dioxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118619077 |
| Molecular Formula | C34H38O6S |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | (3R)-3-cyclopropyl-3-[3-[[13-[(1,1-dioxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)C[C@@H](c1cccc(OCc2ccc3c(c2)-c2ccc(OCC4CCS(=O)(=O)CC4)cc2CCC3)c1)C1CC1 |
| InChI | InChI=1S/C34H38O6S/c35-34(36)20-32(26-9-10-26)28-5-2-6-29(19-28)40-22-24-7-8-25-3-1-4-27-18-30(11-12-31(27)33(25)17-24)39-21-23-13-15-41(37,38)16-14-23/h2,5-8,11-12,17-19,23,26,32H,1,3-4,9-10,13-16,20-22H2,(H,35,36)/t32-/m1/s1 |
| InChIKey | MDLMOTBTGREVBM-JGCGQSQUSA-N |
| XLogP | 6.59 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |