C34H35NO6S — CID 163596732
(3S)-3-[4-[[13-[(1,1-dioxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]-N-oxohex-4-ynamide (PubChem CID 163596732) has the molecular formula C34H35NO6S and a molecular weight of 585.72 g/mol. Its IUPAC name is (3S)-3-[4-[[13-[(1,1-dioxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]-N-oxohex-4-ynamide.
| Compound Name | (3S)-3-[4-[[13-[(1,1-dioxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]-N-oxohex-4-ynamide |
|---|---|
| PubChem CID | 163596732 |
| Molecular Formula | C34H35NO6S |
| Molecular Weight | 585.72 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | (3S)-3-[4-[[13-[(1,1-dioxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]-N-oxohex-4-ynamide |
| SMILES | CC#C[C@@H](CC(=O)N=O)c1ccc(OCc2ccc3c(c2)-c2ccc(OCC4CCS(=O)(=O)CC4)cc2CCC3)cc1 |
| InChI | InChI=1S/C34H35NO6S/c1-2-4-28(21-34(36)35-37)26-9-11-30(12-10-26)40-23-25-7-8-27-5-3-6-29-20-31(13-14-32(29)33(27)19-25)41-22-24-15-17-42(38,39)18-16-24/h7-14,19-20,24,28H,3,5-6,15-18,21-23H2,1H3/t28-/m0/s1 |
| InChIKey | GUBQGZQBSHTBPH-NDEPHWFRSA-N |
| XLogP | 6.41 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.72 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|