C34H38O5S — CID 144692277
3-cyclopropyl-3-[4-[[13-[(1-oxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]propanoic acid (PubChem CID 144692277) has the molecular formula C34H38O5S and a molecular weight of 558.74 g/mol. Its IUPAC name is 3-cyclopropyl-3-[4-[[13-[(1-oxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[4-[[13-[(1-oxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 144692277 |
| Molecular Formula | C34H38O5S |
| Molecular Weight | 558.74 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 3-cyclopropyl-3-[4-[[13-[(1-oxothian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CC(c1ccc(OCc2ccc3c(c2)-c2ccc(OCC4CCS(=O)CC4)cc2CCC3)cc1)C1CC1 |
| InChI | InChI=1S/C34H38O5S/c35-34(36)20-32(26-6-7-26)27-8-10-29(11-9-27)38-22-24-4-5-25-2-1-3-28-19-30(12-13-31(28)33(25)18-24)39-21-23-14-16-40(37)17-15-23/h4-5,8-13,18-19,23,26,32H,1-3,6-7,14-17,20-22H2,(H,35,36) |
| InChIKey | COLKXPAKYKJYCS-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.74 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |