C35H42O6S — CID 118644951
methyl (E)-3-[4-[[13-[(1,1-dihydroxythian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]hex-4-enoate (PubChem CID 118644951) has the molecular formula C35H42O6S and a molecular weight of 590.78 g/mol. Its IUPAC name is methyl (E)-3-[4-[[13-[(1,1-dihydroxythian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]hex-4-enoate.
| Compound Name | methyl (E)-3-[4-[[13-[(1,1-dihydroxythian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]hex-4-enoate |
|---|---|
| PubChem CID | 118644951 |
| Molecular Formula | C35H42O6S |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | methyl (E)-3-[4-[[13-[(1,1-dihydroxythian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]hex-4-enoate |
| SMILES | C/C=C/C(CC(=O)OC)c1ccc(OCc2ccc3c(c2)-c2ccc(OCC4CCS(O)(O)CC4)cc2CCC3)cc1 |
| InChI | InChI=1S/C35H42O6S/c1-3-5-29(22-35(36)39-2)27-10-12-31(13-11-27)40-24-26-8-9-28-6-4-7-30-21-32(14-15-33(30)34(28)20-26)41-23-25-16-18-42(37,38)19-17-25/h3,5,8-15,20-21,25,29,37-38H,4,6-7,16-19,22-24H2,1-2H3/b5-3+ |
| InChIKey | SLLCXNOADFUPEW-HWKANZROSA-N |
| XLogP | 8.18 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|