C31H35FO4 — CID 90842010
methyl (3S)-3-[4-[[4-tert-butyl-3-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]hex-4-enoate (PubChem CID 90842010) has the molecular formula C31H35FO4 and a molecular weight of 490.62 g/mol. Its IUPAC name is methyl (3S)-3-[4-[[4-tert-butyl-3-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]hex-4-enoate.
| Compound Name | methyl (3S)-3-[4-[[4-tert-butyl-3-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]hex-4-enoate |
|---|---|
| PubChem CID | 90842010 |
| Molecular Formula | C31H35FO4 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | methyl (3S)-3-[4-[[4-tert-butyl-3-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]hex-4-enoate |
| SMILES | CC=C[C@H](CC(=O)OC)c1ccc(OCc2ccc(C(C)(C)C)c(-c3cc(OC)ccc3F)c2)cc1 |
| InChI | InChI=1S/C31H35FO4/c1-7-8-23(18-30(33)35-6)22-10-12-24(13-11-22)36-20-21-9-15-28(31(2,3)4)26(17-21)27-19-25(34-5)14-16-29(27)32/h7-17,19,23H,18,20H2,1-6H3/t23-/m1/s1 |
| InChIKey | LIGPZXDXIBKQJZ-HSZRJFAPSA-N |
| XLogP | 7.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|