C27H29FO4 — CID 145499211
methyl 3-[4-[[4-tert-butyl-3-(2-fluoro-5-hydroxyphenyl)phenyl]methoxy]phenyl]propanoate (PubChem CID 145499211) has the molecular formula C27H29FO4 and a molecular weight of 436.52 g/mol. Its IUPAC name is methyl 3-[4-[[4-tert-butyl-3-(2-fluoro-5-hydroxyphenyl)phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[4-tert-butyl-3-(2-fluoro-5-hydroxyphenyl)phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 145499211 |
| Molecular Formula | C27H29FO4 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | methyl 3-[4-[[4-tert-butyl-3-(2-fluoro-5-hydroxyphenyl)phenyl]methoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCc2ccc(C(C)(C)C)c(-c3cc(O)ccc3F)c2)cc1 |
| InChI | InChI=1S/C27H29FO4/c1-27(2,3)24-12-7-19(15-22(24)23-16-20(29)9-13-25(23)28)17-32-21-10-5-18(6-11-21)8-14-26(30)31-4/h5-7,9-13,15-16,29H,8,14,17H2,1-4H3 |
| InChIKey | OCDVEYNOFDOSFG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |