C32H37FO4 — CID 76589019
methyl 3-[4-[[4-tert-butyl-3-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-5-methylhex-4-enoate (PubChem CID 76589019) has the molecular formula C32H37FO4 and a molecular weight of 504.64 g/mol. Its IUPAC name is methyl 3-[4-[[4-tert-butyl-3-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-5-methylhex-4-enoate.
| Compound Name | methyl 3-[4-[[4-tert-butyl-3-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-5-methylhex-4-enoate |
|---|---|
| PubChem CID | 76589019 |
| Molecular Formula | C32H37FO4 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | methyl 3-[4-[[4-tert-butyl-3-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-5-methylhex-4-enoate |
| SMILES | COC(=O)CC(C=C(C)C)c1ccc(OCc2ccc(C(C)(C)C)c(-c3cc(OC)ccc3F)c2)cc1 |
| InChI | InChI=1S/C32H37FO4/c1-21(2)16-24(18-31(34)36-7)23-9-11-25(12-10-23)37-20-22-8-14-29(32(3,4)5)27(17-22)28-19-26(35-6)13-15-30(28)33/h8-17,19,24H,18,20H2,1-7H3 |
| InChIKey | ASJWYIRUMPMFDW-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|