C31H35FO4 — CID 67431532
(E,3S)-3-[3-[[3-tert-butyl-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]hept-4-enoic acid (PubChem CID 67431532) has the molecular formula C31H35FO4 and a molecular weight of 490.62 g/mol. Its IUPAC name is (E,3S)-3-[3-[[3-tert-butyl-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]hept-4-enoic acid.
| Compound Name | (E,3S)-3-[3-[[3-tert-butyl-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 67431532 |
| Molecular Formula | C31H35FO4 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | (E,3S)-3-[3-[[3-tert-butyl-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]hept-4-enoic acid |
| SMILES | CC/C=C/[C@H](CC(=O)O)c1cccc(OCc2ccc(-c3cc(OC)ccc3F)c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C31H35FO4/c1-6-7-9-23(18-30(33)34)22-10-8-11-25(17-22)36-20-21-12-14-26(28(16-21)31(2,3)4)27-19-24(35-5)13-15-29(27)32/h7-17,19,23H,6,18,20H2,1-5H3,(H,33,34)/b9-7+/t23-/m1/s1 |
| InChIKey | NLWISWNZNAQLFT-ISGGHPHESA-N |
| XLogP | 7.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|