C30H33FO4 — CID 76598822
3-[3-[[3-tert-butyl-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-4-methylpent-4-enoic acid (PubChem CID 76598822) has the molecular formula C30H33FO4 and a molecular weight of 476.59 g/mol. Its IUPAC name is 3-[3-[[3-tert-butyl-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-4-methylpent-4-enoic acid.
| Compound Name | 3-[3-[[3-tert-butyl-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-4-methylpent-4-enoic acid |
|---|---|
| PubChem CID | 76598822 |
| Molecular Formula | C30H33FO4 |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 3-[3-[[3-tert-butyl-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-4-methylpent-4-enoic acid |
| SMILES | C=C(C)C(CC(=O)O)c1cccc(OCc2ccc(-c3cc(OC)ccc3F)c(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C30H33FO4/c1-19(2)25(17-29(32)33)21-8-7-9-23(15-21)35-18-20-10-12-24(27(14-20)30(3,4)5)26-16-22(34-6)11-13-28(26)31/h7-16,25H,1,17-18H2,2-6H3,(H,32,33) |
| InChIKey | JBOKBEVNKJXIBD-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|