C33H41FO5 — CID 163477253
(3S)-3-[3-[[4-(2-fluoro-5-methoxyphenyl)-3-hexoxyphenyl]methoxy]phenyl]heptanoic acid (PubChem CID 163477253) has the molecular formula C33H41FO5 and a molecular weight of 536.68 g/mol. Its IUPAC name is (3S)-3-[3-[[4-(2-fluoro-5-methoxyphenyl)-3-hexoxyphenyl]methoxy]phenyl]heptanoic acid.
| Compound Name | (3S)-3-[3-[[4-(2-fluoro-5-methoxyphenyl)-3-hexoxyphenyl]methoxy]phenyl]heptanoic acid |
|---|---|
| PubChem CID | 163477253 |
| Molecular Formula | C33H41FO5 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | (3S)-3-[3-[[4-(2-fluoro-5-methoxyphenyl)-3-hexoxyphenyl]methoxy]phenyl]heptanoic acid |
| SMILES | CCCCCCOc1cc(COc2cccc([C@@H](CCCC)CC(=O)O)c2)ccc1-c1cc(OC)ccc1F |
| InChI | InChI=1S/C33H41FO5/c1-4-6-8-9-18-38-32-19-24(14-16-29(32)30-22-27(37-3)15-17-31(30)34)23-39-28-13-10-12-25(20-28)26(11-7-5-2)21-33(35)36/h10,12-17,19-20,22,26H,4-9,11,18,21,23H2,1-3H3,(H,35,36)/t26-/m0/s1 |
| InChIKey | CBNAYJFUIRQDOX-SANMLTNESA-N |
| XLogP | 8.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|