C30H33FO5 — CID 150618915
3-[2-[[3-butoxy-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-3-cyclopropylpropanoic acid (PubChem CID 150618915) has the molecular formula C30H33FO5 and a molecular weight of 492.59 g/mol. Its IUPAC name is 3-[2-[[3-butoxy-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-3-cyclopropylpropanoic acid.
| Compound Name | 3-[2-[[3-butoxy-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-3-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 150618915 |
| Molecular Formula | C30H33FO5 |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 3-[2-[[3-butoxy-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-3-cyclopropylpropanoic acid |
| SMILES | CCCCOc1cc(COc2ccccc2C(CC(=O)O)C2CC2)ccc1-c1cc(OC)ccc1F |
| InChI | InChI=1S/C30H33FO5/c1-3-4-15-35-29-16-20(9-13-24(29)26-17-22(34-2)12-14-27(26)31)19-36-28-8-6-5-7-23(28)25(18-30(32)33)21-10-11-21/h5-9,12-14,16-17,21,25H,3-4,10-11,15,18-19H2,1-2H3,(H,32,33) |
| InChIKey | IVMCUJIGKYNUAF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|