C37H44FN3O4 — CID 174201391
3-cyclopropyl-3-[3-[[4-(2-fluoro-5-methoxyphenyl)-3-[2-(4-hexyltriazol-1-yl)propan-2-yl]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 174201391) has the molecular formula C37H44FN3O4 and a molecular weight of 613.77 g/mol. Its IUPAC name is 3-cyclopropyl-3-[3-[[4-(2-fluoro-5-methoxyphenyl)-3-[2-(4-hexyltriazol-1-yl)propan-2-yl]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-cyclopropyl-3-[3-[[4-(2-fluoro-5-methoxyphenyl)-3-[2-(4-hexyltriazol-1-yl)propan-2-yl]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 174201391 |
| Molecular Formula | C37H44FN3O4 |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.33 |
| IUPAC Name | 3-cyclopropyl-3-[3-[[4-(2-fluoro-5-methoxyphenyl)-3-[2-(4-hexyltriazol-1-yl)propan-2-yl]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | CCCCCCc1cn(C(C)(C)c2cc(COc3cccc(C(CC(=O)O)C4CC4)c3)ccc2-c2cc(OC)ccc2F)nn1 |
| InChI | InChI=1S/C37H44FN3O4/c1-5-6-7-8-11-28-23-41(40-39-28)37(2,3)34-19-25(13-17-31(34)33-21-29(44-4)16-18-35(33)38)24-45-30-12-9-10-27(20-30)32(22-36(42)43)26-14-15-26/h9-10,12-13,16-21,23,26,32H,5-8,11,14-15,22,24H2,1-4H3,(H,42,43) |
| InChIKey | CVMJYGLWSCXTKM-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|