C30H32FN3O4 — CID 176653292
(3R)-3-[3-[[3-(1-azido-2-methylpropan-2-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-3-cyclopropylpropanoic acid (PubChem CID 176653292) has the molecular formula C30H32FN3O4 and a molecular weight of 517.60 g/mol. Its IUPAC name is (3R)-3-[3-[[3-(1-azido-2-methylpropan-2-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-3-cyclopropylpropanoic acid.
| Compound Name | (3R)-3-[3-[[3-(1-azido-2-methylpropan-2-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-3-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 176653292 |
| Molecular Formula | C30H32FN3O4 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | (3R)-3-[3-[[3-(1-azido-2-methylpropan-2-yl)-4-(2-fluoro-5-methoxyphenyl)phenyl]methoxy]phenyl]-3-cyclopropylpropanoic acid |
| SMILES | COc1ccc(F)c(-c2ccc(COc3cccc([C@H](CC(=O)O)C4CC4)c3)cc2C(C)(C)CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C30H32FN3O4/c1-30(2,18-33-34-32)27-13-19(7-11-24(27)26-15-22(37-3)10-12-28(26)31)17-38-23-6-4-5-21(14-23)25(16-29(35)36)20-8-9-20/h4-7,10-15,20,25H,8-9,16-18H2,1-3H3,(H,35,36)/t25-/m1/s1 |
| InChIKey | VOVWJUAQRXNULD-RUZDIDTESA-N |
| XLogP | 7.64 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|