C22H26O6 — CID 147533315
[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]cyclohexen-1-yl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 147533315) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is [4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]cyclohexen-1-yl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]cyclohexen-1-yl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 147533315 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]cyclohexen-1-yl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)OC1=CCC(c2ccc(OC(=O)C(=C)COC)cc2)CC1 |
| InChI | InChI=1S/C22H26O6/c1-15(13-25-3)21(23)27-19-9-5-17(6-10-19)18-7-11-20(12-8-18)28-22(24)16(2)14-26-4/h5-6,9-11,18H,1-2,7-8,12-14H2,3-4H3 |
| InChIKey | FNMIIHHMSVQANW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|