C19H26O3 — CID 139803597
propyl [4-(4-propylphenyl)cyclohexen-1-yl] carbonate (PubChem CID 139803597) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is propyl [4-(4-propylphenyl)cyclohexen-1-yl] carbonate.
| Compound Name | propyl [4-(4-propylphenyl)cyclohexen-1-yl] carbonate |
|---|---|
| PubChem CID | 139803597 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | propyl [4-(4-propylphenyl)cyclohexen-1-yl] carbonate |
| SMILES | CCCOC(=O)OC1=CCC(c2ccc(CCC)cc2)CC1 |
| InChI | InChI=1S/C19H26O3/c1-3-5-15-6-8-16(9-7-15)17-10-12-18(13-11-17)22-19(20)21-14-4-2/h6-9,12,17H,3-5,10-11,13-14H2,1-2H3 |
| InChIKey | VDHQYEQLGBNUGE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |