C19H15F3O4 — CID 146330916
[2,3-difluoro-4-(2-fluoro-4-formyloxyphenyl)phenyl] 4-methylpent-4-enoate (PubChem CID 146330916) has the molecular formula C19H15F3O4 and a molecular weight of 364.32 g/mol. Its IUPAC name is [2,3-difluoro-4-(2-fluoro-4-formyloxyphenyl)phenyl] 4-methylpent-4-enoate.
| Compound Name | [2,3-difluoro-4-(2-fluoro-4-formyloxyphenyl)phenyl] 4-methylpent-4-enoate |
|---|---|
| PubChem CID | 146330916 |
| Molecular Formula | C19H15F3O4 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [2,3-difluoro-4-(2-fluoro-4-formyloxyphenyl)phenyl] 4-methylpent-4-enoate |
| SMILES | C=C(C)CCC(=O)Oc1ccc(-c2ccc(OC=O)cc2F)c(F)c1F |
| InChI | InChI=1S/C19H15F3O4/c1-11(2)3-8-17(24)26-16-7-6-14(18(21)19(16)22)13-5-4-12(25-10-23)9-15(13)20/h4-7,9-10H,1,3,8H2,2H3 |
| InChIKey | FSLSBYYYZIMSCT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|