C55H55FO11 — CID 59147879
[4-(7-ethenoxy-7-oxoheptoxy)phenyl] 4-[2-[4-fluoro-3-[[4-[4-(8-prop-2-enoyloxyoctoxy)benzoyl]oxyphenyl]methoxy]phenyl]ethynyl]benzoate (PubChem CID 59147879) has the molecular formula C55H55FO11 and a molecular weight of 911.03 g/mol. Its IUPAC name is [4-(7-ethenoxy-7-oxoheptoxy)phenyl] 4-[2-[4-fluoro-3-[[4-[4-(8-prop-2-enoyloxyoctoxy)benzoyl]oxyphenyl]methoxy]phenyl]ethynyl]benzoate.
| Compound Name | [4-(7-ethenoxy-7-oxoheptoxy)phenyl] 4-[2-[4-fluoro-3-[[4-[4-(8-prop-2-enoyloxyoctoxy)benzoyl]oxyphenyl]methoxy]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 59147879 |
| Molecular Formula | C55H55FO11 |
| Molecular Weight | 911.03 g/mol |
| Exact Mass | 910.37 |
| IUPAC Name | [4-(7-ethenoxy-7-oxoheptoxy)phenyl] 4-[2-[4-fluoro-3-[[4-[4-(8-prop-2-enoyloxyoctoxy)benzoyl]oxyphenyl]methoxy]phenyl]ethynyl]benzoate |
| SMILES | C=COC(=O)CCCCCCOc1ccc(OC(=O)c2ccc(C#Cc3ccc(F)c(OCc4ccc(OC(=O)c5ccc(OCCCCCCCCOC(=O)C=C)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C55H55FO11/c1-3-52(57)64-38-14-9-6-5-8-12-36-62-46-29-25-45(26-30-46)55(60)66-48-27-20-43(21-28-48)40-65-51-39-42(22-35-50(51)56)17-16-41-18-23-44(24-19-41)54(59)67-49-33-31-47(32-34-49)63-37-13-10-7-11-15-53(58)61-4-2/h3-4,18-35,39H,1-2,5-15,36-38,40H2 |
| InChIKey | APCMYQCAVGNIPQ-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.03 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|