C53H52O12 — CID 59147886
1-O-[4-(7-ethenoxy-7-oxoheptoxy)phenyl] 4-O-[3-[4-[(E)-2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethenyl]benzoyl]oxyphenyl] benzene-1,4-dicarboxylate (PubChem CID 59147886) has the molecular formula C53H52O12 and a molecular weight of 880.99 g/mol. Its IUPAC name is 1-O-[4-(7-ethenoxy-7-oxoheptoxy)phenyl] 4-O-[3-[4-[(E)-2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethenyl]benzoyl]oxyphenyl] benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[4-(7-ethenoxy-7-oxoheptoxy)phenyl] 4-O-[3-[4-[(E)-2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethenyl]benzoyl]oxyphenyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 59147886 |
| Molecular Formula | C53H52O12 |
| Molecular Weight | 880.99 g/mol |
| Exact Mass | 880.35 |
| IUPAC Name | 1-O-[4-(7-ethenoxy-7-oxoheptoxy)phenyl] 4-O-[3-[4-[(E)-2-[4-(6-prop-2-enoyloxyhexoxy)phenyl]ethenyl]benzoyl]oxyphenyl] benzene-1,4-dicarboxylate |
| SMILES | C=COC(=O)CCCCCCOc1ccc(OC(=O)c2ccc(C(=O)Oc3cccc(OC(=O)c4ccc(/C=C/c5ccc(OCCCCCCOC(=O)C=C)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C53H52O12/c1-3-49(54)62-37-12-8-7-11-36-60-44-29-21-40(22-30-44)18-17-39-19-23-41(24-20-39)52(57)64-47-14-13-15-48(38-47)65-53(58)43-27-25-42(26-28-43)51(56)63-46-33-31-45(32-34-46)61-35-10-6-5-9-16-50(55)59-4-2/h3-4,13-15,17-34,38H,1-2,5-12,16,35-37H2/b18-17+ |
| InChIKey | VLUOOULVUZFEMI-ISLYRVAYSA-N |
| XLogP | 11.20 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.99 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|