C45H51F5O8 — CID 43835995
(2,3,4,5,6-pentafluorophenyl)methyl 5-(4-octoxybenzoyl)oxy-2-[2-(4-octoxyphenoxy)ethoxy]benzoate (PubChem CID 43835995) has the molecular formula C45H51F5O8 and a molecular weight of 814.88 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 5-(4-octoxybenzoyl)oxy-2-[2-(4-octoxyphenoxy)ethoxy]benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 5-(4-octoxybenzoyl)oxy-2-[2-(4-octoxyphenoxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 43835995 |
| Molecular Formula | C45H51F5O8 |
| Molecular Weight | 814.88 g/mol |
| Exact Mass | 814.35 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 5-(4-octoxybenzoyl)oxy-2-[2-(4-octoxyphenoxy)ethoxy]benzoate |
| SMILES | CCCCCCCCOc1ccc(OCCOc2ccc(OC(=O)c3ccc(OCCCCCCCC)cc3)cc2C(=O)OCc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C45H51F5O8/c1-3-5-7-9-11-13-25-53-32-17-15-31(16-18-32)44(51)58-35-23-24-38(36(29-35)45(52)57-30-37-39(46)41(48)43(50)42(49)40(37)47)56-28-27-55-34-21-19-33(20-22-34)54-26-14-12-10-8-6-4-2/h15-24,29H,3-14,25-28,30H2,1-2H3 |
| InChIKey | FEWQFJLCAJZRAO-UHFFFAOYSA-N |
| XLogP | 11.89 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.88 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|