C31H27NO6 — CID 58939391
[4-[2-(4-cyanophenyl)ethynyl]-2-methylphenyl] 4-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]benzoate (PubChem CID 58939391) has the molecular formula C31H27NO6 and a molecular weight of 509.56 g/mol. Its IUPAC name is [4-[2-(4-cyanophenyl)ethynyl]-2-methylphenyl] 4-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]benzoate.
| Compound Name | [4-[2-(4-cyanophenyl)ethynyl]-2-methylphenyl] 4-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 58939391 |
| Molecular Formula | C31H27NO6 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | [4-[2-(4-cyanophenyl)ethynyl]-2-methylphenyl] 4-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]ethoxy]benzoate |
| SMILES | C=C(C)C(=O)OCCOCCOc1ccc(C(=O)Oc2ccc(C#Cc3ccc(C#N)cc3)cc2C)cc1 |
| InChI | InChI=1S/C31H27NO6/c1-22(2)30(33)37-19-17-35-16-18-36-28-13-11-27(12-14-28)31(34)38-29-15-10-25(20-23(29)3)7-4-24-5-8-26(21-32)9-6-24/h5-6,8-15,20H,1,16-19H2,2-3H3 |
| InChIKey | CNDOIDKUDXIDTJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|