C28H30NO7P — CID 170127839
[4-(4-amino-2-methylphenoxy)carbonylphenyl] 4-[4-(2-phosphanylpropanoyloxy)butoxy]benzoate (PubChem CID 170127839) has the molecular formula C28H30NO7P and a molecular weight of 523.52 g/mol. Its IUPAC name is [4-(4-amino-2-methylphenoxy)carbonylphenyl] 4-[4-(2-phosphanylpropanoyloxy)butoxy]benzoate.
| Compound Name | [4-(4-amino-2-methylphenoxy)carbonylphenyl] 4-[4-(2-phosphanylpropanoyloxy)butoxy]benzoate |
|---|---|
| PubChem CID | 170127839 |
| Molecular Formula | C28H30NO7P |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | [4-(4-amino-2-methylphenoxy)carbonylphenyl] 4-[4-(2-phosphanylpropanoyloxy)butoxy]benzoate |
| SMILES | Cc1cc(N)ccc1OC(=O)c1ccc(OC(=O)c2ccc(OCCCCOC(=O)C(C)P)cc2)cc1 |
| InChI | InChI=1S/C28H30NO7P/c1-18-17-22(29)9-14-25(18)36-28(32)21-7-12-24(13-8-21)35-27(31)20-5-10-23(11-6-20)33-15-3-4-16-34-26(30)19(2)37/h5-14,17,19H,3-4,15-16,29,37H2,1-2H3 |
| InChIKey | ITMPIVBLQBBDDR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|