C40H41NO7 — CID 122377471
[4-[2-[4-(4-butoxy-3-methylbenzoyl)oxy-3-methylphenyl]-1,3-oxazol-5-yl]phenyl] 4-butoxy-3-methylbenzoate (PubChem CID 122377471) has the molecular formula C40H41NO7 and a molecular weight of 647.77 g/mol. Its IUPAC name is [4-[2-[4-(4-butoxy-3-methylbenzoyl)oxy-3-methylphenyl]-1,3-oxazol-5-yl]phenyl] 4-butoxy-3-methylbenzoate.
| Compound Name | [4-[2-[4-(4-butoxy-3-methylbenzoyl)oxy-3-methylphenyl]-1,3-oxazol-5-yl]phenyl] 4-butoxy-3-methylbenzoate |
|---|---|
| PubChem CID | 122377471 |
| Molecular Formula | C40H41NO7 |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | [4-[2-[4-(4-butoxy-3-methylbenzoyl)oxy-3-methylphenyl]-1,3-oxazol-5-yl]phenyl] 4-butoxy-3-methylbenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(-c3cnc(-c4ccc(OC(=O)c5ccc(OCCCC)c(C)c5)c(C)c4)o3)cc2)cc1C |
| InChI | InChI=1S/C40H41NO7/c1-6-8-20-44-34-17-13-31(23-26(34)3)39(42)46-33-15-10-29(11-16-33)37-25-41-38(47-37)30-12-19-36(28(5)22-30)48-40(43)32-14-18-35(27(4)24-32)45-21-9-7-2/h10-19,22-25H,6-9,20-21H2,1-5H3 |
| InChIKey | IMMGFCZMGTXXMX-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 97.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|