C39H40N2O7 — CID 102307242
[4-[5-[4-(4-butoxy-2-methylbenzoyl)oxy-3-methylphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-butoxy-2-methylbenzoate (PubChem CID 102307242) has the molecular formula C39H40N2O7 and a molecular weight of 648.76 g/mol. Its IUPAC name is [4-[5-[4-(4-butoxy-2-methylbenzoyl)oxy-3-methylphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-butoxy-2-methylbenzoate.
| Compound Name | [4-[5-[4-(4-butoxy-2-methylbenzoyl)oxy-3-methylphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-butoxy-2-methylbenzoate |
|---|---|
| PubChem CID | 102307242 |
| Molecular Formula | C39H40N2O7 |
| Molecular Weight | 648.76 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | [4-[5-[4-(4-butoxy-2-methylbenzoyl)oxy-3-methylphenyl]-1,3,4-oxadiazol-2-yl]phenyl] 4-butoxy-2-methylbenzoate |
| SMILES | CCCCOc1ccc(C(=O)Oc2ccc(-c3nnc(-c4ccc(OC(=O)c5ccc(OCCCC)cc5C)c(C)c4)o3)cc2)c(C)c1 |
| InChI | InChI=1S/C39H40N2O7/c1-6-8-20-44-31-15-17-33(25(3)23-31)38(42)46-30-13-10-28(11-14-30)36-40-41-37(48-36)29-12-19-35(27(5)22-29)47-39(43)34-18-16-32(24-26(34)4)45-21-9-7-2/h10-19,22-24H,6-9,20-21H2,1-5H3 |
| InChIKey | AHWSXPGAFKJNHE-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 109.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.76 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|