C45H58O11 — CID 143823162
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[8-[4-[2-(prop-2-enoxymethyl)-2-(propoxymethyl)butoxy]benzoyl]oxyoctoxy]benzoate (PubChem CID 143823162) has the molecular formula C45H58O11 and a molecular weight of 774.95 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[8-[4-[2-(prop-2-enoxymethyl)-2-(propoxymethyl)butoxy]benzoyl]oxyoctoxy]benzoate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[8-[4-[2-(prop-2-enoxymethyl)-2-(propoxymethyl)butoxy]benzoyl]oxyoctoxy]benzoate |
|---|---|
| PubChem CID | 143823162 |
| Molecular Formula | C45H58O11 |
| Molecular Weight | 774.95 g/mol |
| Exact Mass | 774.40 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 4-[8-[4-[2-(prop-2-enoxymethyl)-2-(propoxymethyl)butoxy]benzoyl]oxyoctoxy]benzoate |
| SMILES | C=CCOCC(CC)(COCCC)COc1ccc(C(=O)OCCCCCCCCOc2ccc(C(=O)Oc3ccc(/C=C/C(=O)OC)cc3OC)cc2)cc1 |
| InChI | InChI=1S/C45H58O11/c1-6-27-51-32-45(8-3,33-52-28-7-2)34-55-39-23-17-36(18-24-39)43(47)54-30-14-12-10-9-11-13-29-53-38-21-19-37(20-22-38)44(48)56-40-25-15-35(31-41(40)49-4)16-26-42(46)50-5/h6,15-26,31H,1,7-14,27-30,32-34H2,2-5H3/b26-16+ |
| InChIKey | XORUBOMBNFPJHW-WGOQTCKBSA-N |
| XLogP | 9.08 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.95 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|