C24H37Cl3O4Si — CID 142687917
(2E)-2-[(3-methoxy-4-octoxyphenyl)methylidene]-8-trichlorosilyloctanoic acid (PubChem CID 142687917) has the molecular formula C24H37Cl3O4Si and a molecular weight of 524.00 g/mol. Its IUPAC name is (2E)-2-[(3-methoxy-4-octoxyphenyl)methylidene]-8-trichlorosilyloctanoic acid.
| Compound Name | (2E)-2-[(3-methoxy-4-octoxyphenyl)methylidene]-8-trichlorosilyloctanoic acid |
|---|---|
| PubChem CID | 142687917 |
| Molecular Formula | C24H37Cl3O4Si |
| Molecular Weight | 524.00 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | (2E)-2-[(3-methoxy-4-octoxyphenyl)methylidene]-8-trichlorosilyloctanoic acid |
| SMILES | CCCCCCCCOc1ccc(/C=C(\CCCCCC[Si](Cl)(Cl)Cl)C(=O)O)cc1OC |
| InChI | InChI=1S/C24H37Cl3O4Si/c1-3-4-5-6-8-11-16-31-22-15-14-20(19-23(22)30-2)18-21(24(28)29)13-10-7-9-12-17-32(25,26)27/h14-15,18-19H,3-13,16-17H2,1-2H3,(H,28,29)/b21-18+ |
| InChIKey | CHNBMULBUGENBB-DYTRJAOYSA-N |
| XLogP | 8.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.00 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|