C18H24O5 — CID 70408287
(2E)-2-[(3-methoxy-4-pentanoyloxyphenyl)methylidene]pentanoic acid (PubChem CID 70408287) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2E)-2-[(3-methoxy-4-pentanoyloxyphenyl)methylidene]pentanoic acid.
| Compound Name | (2E)-2-[(3-methoxy-4-pentanoyloxyphenyl)methylidene]pentanoic acid |
|---|---|
| PubChem CID | 70408287 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (2E)-2-[(3-methoxy-4-pentanoyloxyphenyl)methylidene]pentanoic acid |
| SMILES | CCCCC(=O)Oc1ccc(/C=C(\CCC)C(=O)O)cc1OC |
| InChI | InChI=1S/C18H24O5/c1-4-6-8-17(19)23-15-10-9-13(12-16(15)22-3)11-14(7-5-2)18(20)21/h9-12H,4-8H2,1-3H3,(H,20,21)/b14-11+ |
| InChIKey | VKKJXDLVEHTPOQ-SDNWHVSQSA-N |
| XLogP | 4.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|