C23H16N2O3 — CID 139642586
1,5-bis(8-hydroxyquinolin-5-yl)penta-1,4-dien-3-one (PubChem CID 139642586) has the molecular formula C23H16N2O3 and a molecular weight of 368.39 g/mol. Its IUPAC name is 1,5-bis(8-hydroxyquinolin-5-yl)penta-1,4-dien-3-one.
| Compound Name | 1,5-bis(8-hydroxyquinolin-5-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 139642586 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 1,5-bis(8-hydroxyquinolin-5-yl)penta-1,4-dien-3-one |
| SMILES | O=C(C=Cc1ccc(O)c2ncccc12)C=Cc1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C23H16N2O3/c26-17(9-5-15-7-11-20(27)22-18(15)3-1-13-24-22)10-6-16-8-12-21(28)23-19(16)4-2-14-25-23/h1-14,27-28H |
| InChIKey | RCTQZXRKEKCMPO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|