C40H48N6O2 — CID 136883501
4-[(4-hexylphenyl)diazenyl]-2-[2-[[5-[(4-hexylphenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]ethyliminomethyl]phenol (PubChem CID 136883501) has the molecular formula C40H48N6O2 and a molecular weight of 644.86 g/mol. Its IUPAC name is 4-[(4-hexylphenyl)diazenyl]-2-[2-[[5-[(4-hexylphenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]ethyliminomethyl]phenol.
| Compound Name | 4-[(4-hexylphenyl)diazenyl]-2-[2-[[5-[(4-hexylphenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]ethyliminomethyl]phenol |
|---|---|
| PubChem CID | 136883501 |
| Molecular Formula | C40H48N6O2 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.38 |
| IUPAC Name | 4-[(4-hexylphenyl)diazenyl]-2-[2-[[5-[(4-hexylphenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]ethyliminomethyl]phenol |
| SMILES | CCCCCCc1ccc(/N=N/c2ccc(O)c(/C=N/CC/N=C/c3cc(/N=N/c4ccc(CCCCCC)cc4)ccc3O)c2)cc1 |
| InChI | InChI=1S/C40H48N6O2/c1-3-5-7-9-11-31-13-17-35(18-14-31)43-45-37-21-23-39(47)33(27-37)29-41-25-26-42-30-34-28-38(22-24-40(34)48)46-44-36-19-15-32(16-20-36)12-10-8-6-4-2/h13-24,27-30,47-48H,3-12,25-26H2,1-2H3/b41-29+,42-30+,45-43+,46-44+ |
| InChIKey | TWKMNSHTSUMSJK-DOUDGZGNSA-N |
| XLogP | 11.71 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|