C11H13F2NO2 — CID 70315596
butyl 3-amino-2,6-difluorobenzoate (PubChem CID 70315596) has the molecular formula C11H13F2NO2 and a molecular weight of 229.23 g/mol. Its IUPAC name is butyl 3-amino-2,6-difluorobenzoate.
| Compound Name | butyl 3-amino-2,6-difluorobenzoate |
|---|---|
| PubChem CID | 70315596 |
| Molecular Formula | C11H13F2NO2 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | butyl 3-amino-2,6-difluorobenzoate |
| SMILES | CCCCOC(=O)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C11H13F2NO2/c1-2-3-6-16-11(15)9-7(12)4-5-8(14)10(9)13/h4-5H,2-3,6,14H2,1H3 |
| InChIKey | LORSLTZSWBJPLP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|