C15H16F7NO3 — CID 142640826
butyl 3-amino-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(hydroxymethyl)benzoate (PubChem CID 142640826) has the molecular formula C15H16F7NO3 and a molecular weight of 391.28 g/mol. Its IUPAC name is butyl 3-amino-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(hydroxymethyl)benzoate.
| Compound Name | butyl 3-amino-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 142640826 |
| Molecular Formula | C15H16F7NO3 |
| Molecular Weight | 391.28 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | butyl 3-amino-6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(hydroxymethyl)benzoate |
| SMILES | CCCCOC(=O)c1c(C(F)(C(F)(F)F)C(F)(F)F)ccc(N)c1CO |
| InChI | InChI=1S/C15H16F7NO3/c1-2-3-6-26-12(25)11-8(7-24)10(23)5-4-9(11)13(16,14(17,18)19)15(20,21)22/h4-5,24H,2-3,6-7,23H2,1H3 |
| InChIKey | GHBZONFQNSBFAC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|