C19H26N2 — CID 83962170
1-N-benzyl-4-N,4-N-dipropylbenzene-1,4-diamine (PubChem CID 83962170) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-N-benzyl-4-N,4-N-dipropylbenzene-1,4-diamine.
| Compound Name | 1-N-benzyl-4-N,4-N-dipropylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 83962170 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-N-benzyl-4-N,4-N-dipropylbenzene-1,4-diamine |
| SMILES | CCCN(CCC)c1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H26N2/c1-3-14-21(15-4-2)19-12-10-18(11-13-19)20-16-17-8-6-5-7-9-17/h5-13,20H,3-4,14-16H2,1-2H3 |
| InChIKey | WEMVELGSMBLMOP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|