C21H37NO6 — CID 150684481
N,N,2-tris[2-(2-methoxyethoxy)ethyl]aniline (PubChem CID 150684481) has the molecular formula C21H37NO6 and a molecular weight of 399.53 g/mol. Its IUPAC name is N,N,2-tris[2-(2-methoxyethoxy)ethyl]aniline.
| Compound Name | N,N,2-tris[2-(2-methoxyethoxy)ethyl]aniline |
|---|---|
| PubChem CID | 150684481 |
| Molecular Formula | C21H37NO6 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | N,N,2-tris[2-(2-methoxyethoxy)ethyl]aniline |
| SMILES | COCCOCCc1ccccc1N(CCOCCOC)CCOCCOC |
| InChI | InChI=1S/C21H37NO6/c1-23-14-17-26-11-8-20-6-4-5-7-21(20)22(9-12-27-18-15-24-2)10-13-28-19-16-25-3/h4-7H,8-19H2,1-3H3 |
| InChIKey | JIOCGMMWFWNSOK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|