C24H18F2O2 — CID 26974088
(Z)-1,5-bis(4-fluorophenyl)-2-methyl-3-phenylpent-2-ene-1,5-dione (PubChem CID 26974088) has the molecular formula C24H18F2O2 and a molecular weight of 376.40 g/mol. Its IUPAC name is (Z)-1,5-bis(4-fluorophenyl)-2-methyl-3-phenylpent-2-ene-1,5-dione.
| Compound Name | (Z)-1,5-bis(4-fluorophenyl)-2-methyl-3-phenylpent-2-ene-1,5-dione |
|---|---|
| PubChem CID | 26974088 |
| Molecular Formula | C24H18F2O2 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (Z)-1,5-bis(4-fluorophenyl)-2-methyl-3-phenylpent-2-ene-1,5-dione |
| SMILES | C/C(C(=O)c1ccc(F)cc1)=C(\CC(=O)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H18F2O2/c1-16(24(28)19-9-13-21(26)14-10-19)22(17-5-3-2-4-6-17)15-23(27)18-7-11-20(25)12-8-18/h2-14H,15H2,1H3/b22-16- |
| InChIKey | CSUIPIKPSABKFG-JWGURIENSA-N |
| XLogP | 5.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|