C22H26F4I2N4O2 — CID 139199292
N-[8-(pyridine-3-carbonylamino)octyl]pyridine-3-carboxamide;1,1,2,2-tetrafluoro-1,2-diiodoethane (PubChem CID 139199292) has the molecular formula C22H26F4I2N4O2 and a molecular weight of 708.28 g/mol. Its IUPAC name is N-[8-(pyridine-3-carbonylamino)octyl]pyridine-3-carboxamide;1,1,2,2-tetrafluoro-1,2-diiodoethane.
| Compound Name | N-[8-(pyridine-3-carbonylamino)octyl]pyridine-3-carboxamide;1,1,2,2-tetrafluoro-1,2-diiodoethane |
|---|---|
| PubChem CID | 139199292 |
| Molecular Formula | C22H26F4I2N4O2 |
| Molecular Weight | 708.28 g/mol |
| Exact Mass | 708.01 |
| IUPAC Name | N-[8-(pyridine-3-carbonylamino)octyl]pyridine-3-carboxamide;1,1,2,2-tetrafluoro-1,2-diiodoethane |
| SMILES | FC(F)(I)C(F)(F)I.O=C(NCCCCCCCCNC(=O)c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C20H26N4O2.C2F4I2/c25-19(17-9-7-11-21-15-17)23-13-5-3-1-2-4-6-14-24-20(26)18-10-8-12-22-16-18;3-1(4,7)2(5,6)8/h7-12,15-16H,1-6,13-14H2,(H,23,25)(H,24,26); |
| InChIKey | HCKMLVMGXBVWDS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.28 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|