C19H16N4O2 — CID 108926051
N-[[2-(pyridine-4-carbonylamino)phenyl]methyl]pyridine-3-carboxamide (PubChem CID 108926051) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[[2-(pyridine-4-carbonylamino)phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[2-(pyridine-4-carbonylamino)phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108926051 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-[[2-(pyridine-4-carbonylamino)phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1NC(=O)c1ccncc1)c1cccnc1 |
| InChI | InChI=1S/C19H16N4O2/c24-18(16-5-3-9-21-12-16)22-13-15-4-1-2-6-17(15)23-19(25)14-7-10-20-11-8-14/h1-12H,13H2,(H,22,24)(H,23,25) |
| InChIKey | XVQZOMNSSZZDHX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |