C20H17N3O5 — CID 108925899
N-[[2-[(3,4,5-trihydroxybenzoyl)amino]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 108925899) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is N-[[2-[(3,4,5-trihydroxybenzoyl)amino]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[2-[(3,4,5-trihydroxybenzoyl)amino]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925899 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[[2-[(3,4,5-trihydroxybenzoyl)amino]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1NC(=O)c1cc(O)c(O)c(O)c1)c1cccnc1 |
| InChI | InChI=1S/C20H17N3O5/c24-16-8-14(9-17(25)18(16)26)20(28)23-15-6-2-1-4-12(15)11-22-19(27)13-5-3-7-21-10-13/h1-10,24-26H,11H2,(H,22,27)(H,23,28) |
| InChIKey | WXLSYNJIGTZZQH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|