C27H23N3O2 — CID 108925855
N-[[2-[(2,2-diphenylacetyl)amino]phenyl]methyl]pyridine-3-carboxamide (PubChem CID 108925855) has the molecular formula C27H23N3O2 and a molecular weight of 421.50 g/mol. Its IUPAC name is N-[[2-[(2,2-diphenylacetyl)amino]phenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[2-[(2,2-diphenylacetyl)amino]phenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925855 |
| Molecular Formula | C27H23N3O2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[[2-[(2,2-diphenylacetyl)amino]phenyl]methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1NC(=O)C(c1ccccc1)c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C27H23N3O2/c31-26(23-15-9-17-28-18-23)29-19-22-14-7-8-16-24(22)30-27(32)25(20-10-3-1-4-11-20)21-12-5-2-6-13-21/h1-18,25H,19H2,(H,29,31)(H,30,32) |
| InChIKey | LTFDGEZHZUEOCI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |