C20H16IN3O2 — CID 108925872
N-[2-[[(2-iodobenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide (PubChem CID 108925872) has the molecular formula C20H16IN3O2 and a molecular weight of 457.27 g/mol. Its IUPAC name is N-[2-[[(2-iodobenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[(2-iodobenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925872 |
| Molecular Formula | C20H16IN3O2 |
| Molecular Weight | 457.27 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | N-[2-[[(2-iodobenzoyl)amino]methyl]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1CNC(=O)c1ccccc1I)c1cccnc1 |
| InChI | InChI=1S/C20H16IN3O2/c21-17-9-3-2-8-16(17)20(26)23-13-14-6-1-4-10-18(14)24-19(25)15-7-5-11-22-12-15/h1-12H,13H2,(H,23,26)(H,24,25) |
| InChIKey | CZDCKBBZOVPCBK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|