C27H35N3O2S3 — CID 88649377
1-tert-butyl-4-(4-tert-butylphenyl)sulfanyloxysulfanylbenzene;N-(2-sulfanylethyl)pyrimidine-5-carboxamide (PubChem CID 88649377) has the molecular formula C27H35N3O2S3 and a molecular weight of 529.80 g/mol. Its IUPAC name is 1-tert-butyl-4-(4-tert-butylphenyl)sulfanyloxysulfanylbenzene;N-(2-sulfanylethyl)pyrimidine-5-carboxamide.
| Compound Name | 1-tert-butyl-4-(4-tert-butylphenyl)sulfanyloxysulfanylbenzene;N-(2-sulfanylethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 88649377 |
| Molecular Formula | C27H35N3O2S3 |
| Molecular Weight | 529.80 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 1-tert-butyl-4-(4-tert-butylphenyl)sulfanyloxysulfanylbenzene;N-(2-sulfanylethyl)pyrimidine-5-carboxamide |
| SMILES | CC(C)(C)c1ccc(SOSc2ccc(C(C)(C)C)cc2)cc1.O=C(NCCS)c1cncnc1 |
| InChI | InChI=1S/C20H26OS2.C7H9N3OS/c1-19(2,3)15-7-11-17(12-8-15)22-21-23-18-13-9-16(10-14-18)20(4,5)6;11-7(10-1-2-12)6-3-8-5-9-4-6/h7-14H,1-6H3;3-5,12H,1-2H2,(H,10,11) |
| InChIKey | CLJOQZDMUCDHAI-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.80 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|