C27H35N3O3 — CID 70417137
1-tert-butyl-4-(4-tert-butylphenoxy)benzene;N-(2-hydroxyethyl)pyrimidine-5-carboxamide (PubChem CID 70417137) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-tert-butyl-4-(4-tert-butylphenoxy)benzene;N-(2-hydroxyethyl)pyrimidine-5-carboxamide.
| Compound Name | 1-tert-butyl-4-(4-tert-butylphenoxy)benzene;N-(2-hydroxyethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 70417137 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 1-tert-butyl-4-(4-tert-butylphenoxy)benzene;N-(2-hydroxyethyl)pyrimidine-5-carboxamide |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(C(C)(C)C)cc2)cc1.O=C(NCCO)c1cncnc1 |
| InChI | InChI=1S/C20H26O.C7H9N3O2/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;11-2-1-10-7(12)6-3-8-5-9-4-6/h7-14H,1-6H3;3-5,11H,1-2H2,(H,10,12) |
| InChIKey | IGUYLUGGCHOELJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |