C25H23NO4 — CID 88960429
(2Z,4E)-5-[8-[(1E,3Z)-4-carboxybuta-1,3-dienyl]-6,11-dihydro-5H-benzo[b][1]benzazepin-3-yl]-2-methylpenta-2,4-dienoic acid (PubChem CID 88960429) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is (2Z,4E)-5-[8-[(1E,3Z)-4-carboxybuta-1,3-dienyl]-6,11-dihydro-5H-benzo[b][1]benzazepin-3-yl]-2-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-[8-[(1E,3Z)-4-carboxybuta-1,3-dienyl]-6,11-dihydro-5H-benzo[b][1]benzazepin-3-yl]-2-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 88960429 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | (2Z,4E)-5-[8-[(1E,3Z)-4-carboxybuta-1,3-dienyl]-6,11-dihydro-5H-benzo[b][1]benzazepin-3-yl]-2-methylpenta-2,4-dienoic acid |
| SMILES | C/C(=C/C=C/c1ccc2c(c1)CCc1cc(/C=C/C=C\C(=O)O)ccc1N2)C(=O)O |
| InChI | InChI=1S/C25H23NO4/c1-17(25(29)30)5-4-7-19-10-14-23-21(16-19)12-11-20-15-18(9-13-22(20)26-23)6-2-3-8-24(27)28/h2-10,13-16,26H,11-12H2,1H3,(H,27,28)(H,29,30)/b6-2+,7-4+,8-3-,17-5- |
| InChIKey | BYVWPTBULKVNQQ-CUZYOHGWSA-N |
| XLogP | 5.23 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|