C14H15BrO — CID 170498148
6-(4-bromobut-1-enyl)-3,4-dihydro-1H-naphthalen-2-one (PubChem CID 170498148) has the molecular formula C14H15BrO and a molecular weight of 279.18 g/mol. Its IUPAC name is 6-(4-bromobut-1-enyl)-3,4-dihydro-1H-naphthalen-2-one.
| Compound Name | 6-(4-bromobut-1-enyl)-3,4-dihydro-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 170498148 |
| Molecular Formula | C14H15BrO |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 6-(4-bromobut-1-enyl)-3,4-dihydro-1H-naphthalen-2-one |
| SMILES | O=C1CCc2cc(C=CCCBr)ccc2C1 |
| InChI | InChI=1S/C14H15BrO/c15-8-2-1-3-11-4-5-13-10-14(16)7-6-12(13)9-11/h1,3-5,9H,2,6-8,10H2 |
| InChIKey | WQENNLDTDFKHGP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|