C13H14O2 — CID 170476722
6-(4-hydroxybut-1-enyl)-2,3-dihydroinden-1-one (PubChem CID 170476722) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 6-(4-hydroxybut-1-enyl)-2,3-dihydroinden-1-one.
| Compound Name | 6-(4-hydroxybut-1-enyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 170476722 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 6-(4-hydroxybut-1-enyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2ccc(C=CCCO)cc21 |
| InChI | InChI=1S/C13H14O2/c14-8-2-1-3-10-4-5-11-6-7-13(15)12(11)9-10/h1,3-5,9,14H,2,6-8H2 |
| InChIKey | NBUKZDRUIJTUHC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |