C15H18O4S — CID 170822679
S-[2,3-dihydroxy-3-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)propyl] ethanethioate (PubChem CID 170822679) has the molecular formula C15H18O4S and a molecular weight of 294.37 g/mol. Its IUPAC name is S-[2,3-dihydroxy-3-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)propyl] ethanethioate.
| Compound Name | S-[2,3-dihydroxy-3-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)propyl] ethanethioate |
|---|---|
| PubChem CID | 170822679 |
| Molecular Formula | C15H18O4S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | S-[2,3-dihydroxy-3-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)propyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1ccc2c(c1)CCC(=O)C2 |
| InChI | InChI=1S/C15H18O4S/c1-9(16)20-8-14(18)15(19)12-3-2-11-7-13(17)5-4-10(11)6-12/h2-3,6,14-15,18-19H,4-5,7-8H2,1H3 |
| InChIKey | XFINNBAICIVUIY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|