C19H19NO3 — CID 18190716
(E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-methyl-N-phenylprop-2-enamide (PubChem CID 18190716) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-methyl-N-phenylprop-2-enamide.
| Compound Name | (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-methyl-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 18190716 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-N-methyl-N-phenylprop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1ccc2c(c1)OCCCO2)c1ccccc1 |
| InChI | InChI=1S/C19H19NO3/c1-20(16-6-3-2-4-7-16)19(21)11-9-15-8-10-17-18(14-15)23-13-5-12-22-17/h2-4,6-11,14H,5,12-13H2,1H3/b11-9+ |
| InChIKey | GOVSFUMCKJWYQX-PKNBQFBNSA-N |
| XLogP | 3.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|