C18H16O6 — CID 70332544
2,3-dihydro-1,4-benzodioxin-6-yl (E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enoate (PubChem CID 70332544) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl (E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enoate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl (E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 70332544 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl (E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(CO)c1)Oc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H16O6/c19-11-13-9-12(1-4-15(13)20)2-6-18(21)24-14-3-5-16-17(10-14)23-8-7-22-16/h1-6,9-10,19-20H,7-8,11H2/b6-2+ |
| InChIKey | FFSIJJKFEGHTGI-QHHAFSJGSA-N |
| XLogP | 2.27 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|