C21H20O6 — CID 123887226
(2,2-dimethyl-1,3-benzodioxol-5-yl) 5-[4-hydroxy-3-(hydroxymethyl)phenyl]penta-2,4-dienoate (PubChem CID 123887226) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-benzodioxol-5-yl) 5-[4-hydroxy-3-(hydroxymethyl)phenyl]penta-2,4-dienoate.
| Compound Name | (2,2-dimethyl-1,3-benzodioxol-5-yl) 5-[4-hydroxy-3-(hydroxymethyl)phenyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 123887226 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (2,2-dimethyl-1,3-benzodioxol-5-yl) 5-[4-hydroxy-3-(hydroxymethyl)phenyl]penta-2,4-dienoate |
| SMILES | CC1(C)Oc2ccc(OC(=O)C=CC=Cc3ccc(O)c(CO)c3)cc2O1 |
| InChI | InChI=1S/C21H20O6/c1-21(2)26-18-10-8-16(12-19(18)27-21)25-20(24)6-4-3-5-14-7-9-17(23)15(11-14)13-22/h3-12,22-23H,13H2,1-2H3 |
| InChIKey | XNHVWYPAAOENRA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|