C13H14O5 — CID 130295541
(3Z,5E)-1,4-dihydroxy-6-[4-hydroxy-3-(hydroxymethyl)phenyl]hexa-3,5-dien-2-one (PubChem CID 130295541) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is (3Z,5E)-1,4-dihydroxy-6-[4-hydroxy-3-(hydroxymethyl)phenyl]hexa-3,5-dien-2-one.
| Compound Name | (3Z,5E)-1,4-dihydroxy-6-[4-hydroxy-3-(hydroxymethyl)phenyl]hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 130295541 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (3Z,5E)-1,4-dihydroxy-6-[4-hydroxy-3-(hydroxymethyl)phenyl]hexa-3,5-dien-2-one |
| SMILES | O=C(/C=C(O)/C=C/c1ccc(O)c(CO)c1)CO |
| InChI | InChI=1S/C13H14O5/c14-7-10-5-9(2-4-13(10)18)1-3-11(16)6-12(17)8-15/h1-6,14-16,18H,7-8H2/b3-1+,11-6- |
| InChIKey | JDQBJHAHAUWOQD-OTCDTDDGSA-N |
| XLogP | 0.90 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|