C19H17ClO5 — CID 123470022
1-(2-chloro-4-hydroxy-3-methoxyphenyl)-5-[4-hydroxy-3-(hydroxymethyl)phenyl]penta-1,4-dien-3-one (PubChem CID 123470022) has the molecular formula C19H17ClO5 and a molecular weight of 360.79 g/mol. Its IUPAC name is 1-(2-chloro-4-hydroxy-3-methoxyphenyl)-5-[4-hydroxy-3-(hydroxymethyl)phenyl]penta-1,4-dien-3-one.
| Compound Name | 1-(2-chloro-4-hydroxy-3-methoxyphenyl)-5-[4-hydroxy-3-(hydroxymethyl)phenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 123470022 |
| Molecular Formula | C19H17ClO5 |
| Molecular Weight | 360.79 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 1-(2-chloro-4-hydroxy-3-methoxyphenyl)-5-[4-hydroxy-3-(hydroxymethyl)phenyl]penta-1,4-dien-3-one |
| SMILES | COc1c(O)ccc(C=CC(=O)C=Cc2ccc(O)c(CO)c2)c1Cl |
| InChI | InChI=1S/C19H17ClO5/c1-25-19-17(24)9-5-13(18(19)20)4-7-15(22)6-2-12-3-8-16(23)14(10-12)11-21/h2-10,21,23-24H,11H2,1H3 |
| InChIKey | NNLAYDYLDVTBTJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|